About [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde
[4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde (PubChem CID 143730124) has the molecular formula C23H20FNO3
and a molecular weight of 377.42 g/mol. Its IUPAC name is [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde.
Molecular Properties
| Compound Name | [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde |
| PubChem CID | 143730124 |
| Molecular Formula | C23H20FNO3 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde |
| SMILES | C=O.Cc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(F)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C22H18FNO2.CH2O/c1-15-3-7-18(8-4-15)22(25)26-20-10-5-17(6-11-20)14-24-19-9-12-21(23)16(2)13-19;1-2/h3-14H,1-2H3;1H2/b24-14+; |
| InChIKey | RBLOLOYPGWPBND-SXMBIPSUSA-N |
| XLogP | 5.23 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde?
The IUPAC name of [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde (CID 143730124) is [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde.
What is the SMILES notation for [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde?
The canonical SMILES for [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde is C=O.Cc1ccc(C(=O)Oc2ccc(/C=N/c3ccc(F)c(C)c3)cc2)cc1.
What is the InChIKey of [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde?
The InChIKey is RBLOLOYPGWPBND-SXMBIPSUSA-N. The full InChI is InChI=1S/C22H18FNO2.CH2O/c1-15-3-7-18(8-4-15)22(25)26-20-10-5-17(6-11-20)14-24-19-9-12-21(23)16(2)13-19;1-2/h3-14H,1-2H3;1H2/b24-14+;.
What are the key properties of [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde?
[4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde has a molecular weight of 377.42 g/mol, XLogP of 5.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-fluoro-3-methylphenyl)iminomethyl]phenyl] 4-methylbenzoate;formaldehyde is sourced from PubChem (CID 143730124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).