C28H49NO — CID 143730774
N-butyl-N-(4-hexylphenyl)formamide;2,5-dimethylhexa-2,4-diene;propane (PubChem CID 143730774) has the molecular formula C28H49NO and a molecular weight of 415.71 g/mol. Its IUPAC name is N-butyl-N-(4-hexylphenyl)formamide;2,5-dimethylhexa-2,4-diene;propane.
| Compound Name | N-butyl-N-(4-hexylphenyl)formamide;2,5-dimethylhexa-2,4-diene;propane |
|---|---|
| PubChem CID | 143730774 |
| Molecular Formula | C28H49NO |
| Molecular Weight | 415.71 g/mol |
| Exact Mass | 415.38 |
| IUPAC Name | N-butyl-N-(4-hexylphenyl)formamide;2,5-dimethylhexa-2,4-diene;propane |
| SMILES | CC(C)=CC=C(C)C.CCC.CCCCCCc1ccc(N(C=O)CCCC)cc1 |
| InChI | InChI=1S/C17H27NO.C8H14.C3H8/c1-3-5-7-8-9-16-10-12-17(13-11-16)18(15-19)14-6-4-2;1-7(2)5-6-8(3)4;1-3-2/h10-13,15H,3-9,14H2,1-2H3;5-6H,1-4H3;3H2,1-2H3 |
| InChIKey | KWJUFUAGGALTMI-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.71 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|