C10H15NO2S — CID 143730948
methyl (2E)-3-methyl-4-(1-methylsulfanylethylideneamino)penta-2,4-dienoate (PubChem CID 143730948) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is methyl (2E)-3-methyl-4-(1-methylsulfanylethylideneamino)penta-2,4-dienoate.
| Compound Name | methyl (2E)-3-methyl-4-(1-methylsulfanylethylideneamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 143730948 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | methyl (2E)-3-methyl-4-(1-methylsulfanylethylideneamino)penta-2,4-dienoate |
| SMILES | C=C(/N=C(\C)SC)/C(C)=C/C(=O)OC |
| InChI | InChI=1S/C10H15NO2S/c1-7(6-10(12)13-4)8(2)11-9(3)14-5/h6H,2H2,1,3-5H3/b7-6+,11-9+ |
| InChIKey | CYZLNKFVLADNIW-RXUIJTJXSA-N |
| XLogP | 2.40 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|