C21H30N5+ — CID 143731842
N-ethyl-N-propan-2-yl-4-[3-(1H-pyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]cyclohexan-1-amine (PubChem CID 143731842) has the molecular formula C21H30N5+ and a molecular weight of 352.51 g/mol. Its IUPAC name is N-ethyl-N-propan-2-yl-4-[3-(1H-pyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]cyclohexan-1-amine.
| Compound Name | N-ethyl-N-propan-2-yl-4-[3-(1H-pyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 143731842 |
| Molecular Formula | C21H30N5+ |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | N-ethyl-N-propan-2-yl-4-[3-(1H-pyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]cyclohexan-1-amine |
| SMILES | CCN(C(C)C)C1CCC(c2cnc3[nH]cc(C4=C[NH2+]N=C4)c3c2)CC1 |
| InChI | InChI=1S/C21H29N5/c1-4-26(14(2)3)18-7-5-15(6-8-18)16-9-19-20(17-11-24-25-12-17)13-23-21(19)22-10-16/h9-15,18H,4-8H2,1-3H3,(H,22,23)(H,24,25)/p+1 |
| InChIKey | QFYFFMXSGSWNFO-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 60.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|