C18H21N4+ — CID 143731633
5-(4,4-dimethylcyclohexen-1-yl)-3-(1H-pyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 143731633) has the molecular formula C18H21N4+ and a molecular weight of 293.39 g/mol. Its IUPAC name is 5-(4,4-dimethylcyclohexen-1-yl)-3-(1H-pyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(4,4-dimethylcyclohexen-1-yl)-3-(1H-pyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 143731633 |
| Molecular Formula | C18H21N4+ |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 5-(4,4-dimethylcyclohexen-1-yl)-3-(1H-pyrazol-1-ium-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC1(C)CC=C(c2cnc3[nH]cc(C4=C[NH2+]N=C4)c3c2)CC1 |
| InChI | InChI=1S/C18H20N4/c1-18(2)5-3-12(4-6-18)13-7-15-16(14-9-21-22-10-14)11-20-17(15)19-8-13/h3,7-11H,4-6H2,1-2H3,(H,19,20)(H,21,22)/p+1 |
| InChIKey | IAHWTFKNFNVBLH-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 57.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|