C22H25Cl2N4O2P — CID 143735216
2-chloro-N-[2-[4-chloro-2-[[(3R,5S)-3,5-dimethylpiperidin-1-yl]-phosphanylidenemethyl]anilino]-2-oxoethyl]pyridine-3-carboxamide (PubChem CID 143735216) has the molecular formula C22H25Cl2N4O2P and a molecular weight of 479.35 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-chloro-2-[[(3R,5S)-3,5-dimethylpiperidin-1-yl]-phosphanylidenemethyl]anilino]-2-oxoethyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[2-[4-chloro-2-[[(3R,5S)-3,5-dimethylpiperidin-1-yl]-phosphanylidenemethyl]anilino]-2-oxoethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143735216 |
| Molecular Formula | C22H25Cl2N4O2P |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 2-chloro-N-[2-[4-chloro-2-[[(3R,5S)-3,5-dimethylpiperidin-1-yl]-phosphanylidenemethyl]anilino]-2-oxoethyl]pyridine-3-carboxamide |
| SMILES | [H]/P=C(/c1cc(Cl)ccc1NC(=O)CNC(=O)c1cccnc1Cl)N1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C22H25Cl2N4O2P/c1-13-8-14(2)12-28(11-13)22(31)17-9-15(23)5-6-18(17)27-19(29)10-26-21(30)16-4-3-7-25-20(16)24/h3-7,9,13-14,31H,8,10-12H2,1-2H3,(H,26,30)(H,27,29)/t13-,14+ |
| InChIKey | JWWSLHDKRTVNNN-OKILXGFUSA-N |
| XLogP | 4.36 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|