C24H30Cl2N4O2 — CID 89247091
(2Z,4Z)-5-amino-N-[2-[4-chloro-2-[1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethenyl]anilino]-2-oxoethyl]-2-(1-chloroethenyl)penta-2,4-dienamide (PubChem CID 89247091) has the molecular formula C24H30Cl2N4O2 and a molecular weight of 477.44 g/mol. Its IUPAC name is (2Z,4Z)-5-amino-N-[2-[4-chloro-2-[1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethenyl]anilino]-2-oxoethyl]-2-(1-chloroethenyl)penta-2,4-dienamide.
| Compound Name | (2Z,4Z)-5-amino-N-[2-[4-chloro-2-[1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethenyl]anilino]-2-oxoethyl]-2-(1-chloroethenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 89247091 |
| Molecular Formula | C24H30Cl2N4O2 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (2Z,4Z)-5-amino-N-[2-[4-chloro-2-[1-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethenyl]anilino]-2-oxoethyl]-2-(1-chloroethenyl)penta-2,4-dienamide |
| SMILES | C=C(Cl)/C(=C\C=C/N)C(=O)NCC(=O)Nc1ccc(Cl)cc1C(=C)N1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C24H30Cl2N4O2/c1-15-10-16(2)14-30(13-15)18(4)21-11-19(26)7-8-22(21)29-23(31)12-28-24(32)20(17(3)25)6-5-9-27/h5-9,11,15-16H,3-4,10,12-14,27H2,1-2H3,(H,28,32)(H,29,31)/b9-5-,20-6+/t15-,16+ |
| InChIKey | BIQXOMHHUUWSBW-ALDYKNLMSA-N |
| XLogP | 4.49 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|