C43H62FNO — CID 143736314
ethane;2-ethyl-1-methoxy-4-[(3E)-5,6,7-trimethylocta-1,3,7-trien-4-yl]benzene;4-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)piperidine (PubChem CID 143736314) has the molecular formula C43H62FNO and a molecular weight of 627.97 g/mol. Its IUPAC name is ethane;2-ethyl-1-methoxy-4-[(3E)-5,6,7-trimethylocta-1,3,7-trien-4-yl]benzene;4-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)piperidine.
| Compound Name | ethane;2-ethyl-1-methoxy-4-[(3E)-5,6,7-trimethylocta-1,3,7-trien-4-yl]benzene;4-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)piperidine |
|---|---|
| PubChem CID | 143736314 |
| Molecular Formula | C43H62FNO |
| Molecular Weight | 627.97 g/mol |
| Exact Mass | 627.48 |
| IUPAC Name | ethane;2-ethyl-1-methoxy-4-[(3E)-5,6,7-trimethylocta-1,3,7-trien-4-yl]benzene;4-[(4-fluorophenyl)methyl]-1-(4-methylphenyl)piperidine |
| SMILES | C=C/C=C(/c1ccc(OC)c(CC)c1)C(C)C(C)C(=C)C.CC.CC.Cc1ccc(N2CCC(Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H28O.C19H22FN.2C2H6/c1-8-10-19(16(6)15(5)14(3)4)18-11-12-20(21-7)17(9-2)13-18;1-15-2-8-19(9-3-15)21-12-10-17(11-13-21)14-16-4-6-18(20)7-5-16;2*1-2/h8,10-13,15-16H,1,3,9H2,2,4-7H3;2-9,17H,10-14H2,1H3;2*1-2H3/b19-10+;;; |
| InChIKey | KZUPMXDPUARDHP-DWZOPUQCSA-N |
| XLogP | 12.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.97 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|