C30H38FNO5 — CID 142243982
(E)-3-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxy-2-methylphenyl]-2-oxohex-3-enoic acid;propane (PubChem CID 142243982) has the molecular formula C30H38FNO5 and a molecular weight of 511.63 g/mol. Its IUPAC name is (E)-3-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxy-2-methylphenyl]-2-oxohex-3-enoic acid;propane.
| Compound Name | (E)-3-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxy-2-methylphenyl]-2-oxohex-3-enoic acid;propane |
|---|---|
| PubChem CID | 142243982 |
| Molecular Formula | C30H38FNO5 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | (E)-3-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxy-2-methylphenyl]-2-oxohex-3-enoic acid;propane |
| SMILES | CC/C=C(/C(=O)C(=O)O)c1cc(C(=O)N2CCC(Cc3ccc(F)cc3)CC2)c(OC)cc1C.CCC |
| InChI | InChI=1S/C27H30FNO5.C3H8/c1-4-5-21(25(30)27(32)33)22-16-23(24(34-3)14-17(22)2)26(31)29-12-10-19(11-13-29)15-18-6-8-20(28)9-7-18;1-3-2/h5-9,14,16,19H,4,10-13,15H2,1-3H3,(H,32,33);3H2,1-2H3/b21-5+; |
| InChIKey | LNVIYBCDAGXCFM-NRAHUFNESA-N |
| XLogP | 6.10 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|