C28H34ClFN2O2 — CID 142871656
(E)-3-[4-chloro-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-2-methylphenyl]-2-methylidenepent-3-enamide;ethane (PubChem CID 142871656) has the molecular formula C28H34ClFN2O2 and a molecular weight of 485.04 g/mol. Its IUPAC name is (E)-3-[4-chloro-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-2-methylphenyl]-2-methylidenepent-3-enamide;ethane.
| Compound Name | (E)-3-[4-chloro-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-2-methylphenyl]-2-methylidenepent-3-enamide;ethane |
|---|---|
| PubChem CID | 142871656 |
| Molecular Formula | C28H34ClFN2O2 |
| Molecular Weight | 485.04 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (E)-3-[4-chloro-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-2-methylphenyl]-2-methylidenepent-3-enamide;ethane |
| SMILES | C=C(C(N)=O)/C(=C/C)c1cc(C(=O)N2CCC(Cc3ccc(F)cc3)CC2)c(Cl)cc1C.CC |
| InChI | InChI=1S/C26H28ClFN2O2.C2H6/c1-4-21(17(3)25(29)31)22-15-23(24(27)13-16(22)2)26(32)30-11-9-19(10-12-30)14-18-5-7-20(28)8-6-18;1-2/h4-8,13,15,19H,3,9-12,14H2,1-2H3,(H2,29,31);1-2H3/b21-4-; |
| InChIKey | XOZSBSBOBMYVQV-LGYNVNGDSA-N |
| XLogP | 6.35 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.04 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|