C34H46FNO2 — CID 142907562
ethene;ethenol;[2-ethyl-4-methyl-5-[(4Z)-octa-1,4-dien-4-yl]phenyl]-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone (PubChem CID 142907562) has the molecular formula C34H46FNO2 and a molecular weight of 519.75 g/mol. Its IUPAC name is ethene;ethenol;[2-ethyl-4-methyl-5-[(4Z)-octa-1,4-dien-4-yl]phenyl]-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone.
| Compound Name | ethene;ethenol;[2-ethyl-4-methyl-5-[(4Z)-octa-1,4-dien-4-yl]phenyl]-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 142907562 |
| Molecular Formula | C34H46FNO2 |
| Molecular Weight | 519.75 g/mol |
| Exact Mass | 519.35 |
| IUPAC Name | ethene;ethenol;[2-ethyl-4-methyl-5-[(4Z)-octa-1,4-dien-4-yl]phenyl]-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone |
| SMILES | C=C.C=CC/C(=C/CCC)c1cc(C(=O)N2CCC(Cc3ccc(F)cc3)CC2)c(CC)cc1C.C=CO |
| InChI | InChI=1S/C30H38FNO.C2H4O.C2H4/c1-5-8-10-26(9-6-2)28-21-29(25(7-3)19-22(28)4)30(33)32-17-15-24(16-18-32)20-23-11-13-27(31)14-12-23;1-2-3;1-2/h6,10-14,19,21,24H,2,5,7-9,15-18,20H2,1,3-4H3;2-3H,1H2;1-2H2/b26-10-;; |
| InChIKey | QCHOFTYEOUVJTO-LDUGYOCQSA-N |
| XLogP | 9.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.75 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|