C34H47FN2 — CID 142906898
5-[1-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]ethenyl]-6-methyl-3-oct-1-en-2-yl-1H-indole;propane (PubChem CID 142906898) has the molecular formula C34H47FN2 and a molecular weight of 502.76 g/mol. Its IUPAC name is 5-[1-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]ethenyl]-6-methyl-3-oct-1-en-2-yl-1H-indole;propane.
| Compound Name | 5-[1-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]ethenyl]-6-methyl-3-oct-1-en-2-yl-1H-indole;propane |
|---|---|
| PubChem CID | 142906898 |
| Molecular Formula | C34H47FN2 |
| Molecular Weight | 502.76 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | 5-[1-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]ethenyl]-6-methyl-3-oct-1-en-2-yl-1H-indole;propane |
| SMILES | C=C(CCCCCC)c1c[nH]c2cc(C)c(C(=C)N3CCC(Cc4ccc(F)cc4)CC3)cc12.CCC |
| InChI | InChI=1S/C31H39FN2.C3H8/c1-5-6-7-8-9-22(2)30-21-33-31-18-23(3)28(20-29(30)31)24(4)34-16-14-26(15-17-34)19-25-10-12-27(32)13-11-25;1-3-2/h10-13,18,20-21,26,33H,2,4-9,14-17,19H2,1,3H3;3H2,1-2H3 |
| InChIKey | YDJFSZBTSLETSM-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.76 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|