C30H40FN3O4 — CID 143180174
[5-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-2-hydroxyphenyl]-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone;N-pentylformamide (PubChem CID 143180174) has the molecular formula C30H40FN3O4 and a molecular weight of 525.67 g/mol. Its IUPAC name is [5-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-2-hydroxyphenyl]-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone;N-pentylformamide.
| Compound Name | [5-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-2-hydroxyphenyl]-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone;N-pentylformamide |
|---|---|
| PubChem CID | 143180174 |
| Molecular Formula | C30H40FN3O4 |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | [5-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-2-hydroxyphenyl]-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone;N-pentylformamide |
| SMILES | CC1(C)CC(c2ccc(O)c(C(=O)N3CCC(Cc4ccc(F)cc4)CC3)c2)=NO1.CCCCCNC=O |
| InChI | InChI=1S/C24H27FN2O3.C6H13NO/c1-24(2)15-21(26-30-24)18-5-8-22(28)20(14-18)23(29)27-11-9-17(10-12-27)13-16-3-6-19(25)7-4-16;1-2-3-4-5-7-6-8/h3-8,14,17,28H,9-13,15H2,1-2H3;6H,2-5H2,1H3,(H,7,8) |
| InChIKey | WARPKXXSIXXZML-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|