C25H28FN3O5 — CID 89382423
3-[2-amino-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxyphenyl]-N,N-dimethyl-2,3-dioxopropanamide (PubChem CID 89382423) has the molecular formula C25H28FN3O5 and a molecular weight of 469.51 g/mol. Its IUPAC name is 3-[2-amino-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxyphenyl]-N,N-dimethyl-2,3-dioxopropanamide.
| Compound Name | 3-[2-amino-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxyphenyl]-N,N-dimethyl-2,3-dioxopropanamide |
|---|---|
| PubChem CID | 89382423 |
| Molecular Formula | C25H28FN3O5 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-[2-amino-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxyphenyl]-N,N-dimethyl-2,3-dioxopropanamide |
| SMILES | COc1cc(N)c(C(=O)C(=O)C(=O)N(C)C)cc1C(=O)N1CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H28FN3O5/c1-28(2)25(33)23(31)22(30)18-13-19(21(34-3)14-20(18)27)24(32)29-10-8-16(9-11-29)12-15-4-6-17(26)7-5-15/h4-7,13-14,16H,8-12,27H2,1-3H3 |
| InChIKey | AUWWMGKNQUWZJY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|