C24H25ClFN5O3 — CID 58907983
2-[1-amino-6-chloro-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 58907983) has the molecular formula C24H25ClFN5O3 and a molecular weight of 485.95 g/mol. Its IUPAC name is 2-[1-amino-6-chloro-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[1-amino-6-chloro-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 58907983 |
| Molecular Formula | C24H25ClFN5O3 |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 2-[1-amino-6-chloro-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | CN(C)C(=O)C(=O)c1cn(N)c2nc(Cl)c(C(=O)N3CCC(Cc4ccc(F)cc4)CC3)cc12 |
| InChI | InChI=1S/C24H25ClFN5O3/c1-29(2)24(34)20(32)19-13-31(27)22-17(19)12-18(21(25)28-22)23(33)30-9-7-15(8-10-30)11-14-3-5-16(26)6-4-14/h3-6,12-13,15H,7-11,27H2,1-2H3 |
| InChIKey | NDTSWKDGOCJARQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|