C24H28N4O4S — CID 21100640
2-[1-amino-6-methoxy-5-[4-(thiophen-3-ylmethyl)piperidine-1-carbonyl]indol-3-yl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 21100640) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-[1-amino-6-methoxy-5-[4-(thiophen-3-ylmethyl)piperidine-1-carbonyl]indol-3-yl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[1-amino-6-methoxy-5-[4-(thiophen-3-ylmethyl)piperidine-1-carbonyl]indol-3-yl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 21100640 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-[1-amino-6-methoxy-5-[4-(thiophen-3-ylmethyl)piperidine-1-carbonyl]indol-3-yl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | COc1cc2c(cc1C(=O)N1CCC(Cc3ccsc3)CC1)c(C(=O)C(=O)N(C)C)cn2N |
| InChI | InChI=1S/C24H28N4O4S/c1-26(2)24(31)22(29)19-13-28(25)20-12-21(32-3)18(11-17(19)20)23(30)27-7-4-15(5-8-27)10-16-6-9-33-14-16/h6,9,11-15H,4-5,7-8,10,25H2,1-3H3 |
| InChIKey | TXXPRUMGJHOVHZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|