C11H15F3N4 — CID 143737891
4-pyrrolidin-1-yl-6-(3,3,3-trifluoropropyl)pyrimidin-2-amine (PubChem CID 143737891) has the molecular formula C11H15F3N4 and a molecular weight of 260.26 g/mol. Its IUPAC name is 4-pyrrolidin-1-yl-6-(3,3,3-trifluoropropyl)pyrimidin-2-amine.
| Compound Name | 4-pyrrolidin-1-yl-6-(3,3,3-trifluoropropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 143737891 |
| Molecular Formula | C11H15F3N4 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-pyrrolidin-1-yl-6-(3,3,3-trifluoropropyl)pyrimidin-2-amine |
| SMILES | Nc1nc(CCC(F)(F)F)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C11H15F3N4/c12-11(13,14)4-3-8-7-9(17-10(15)16-8)18-5-1-2-6-18/h7H,1-6H2,(H2,15,16,17) |
| InChIKey | AYICUOGOIGLGAW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |