C33H39FN2O6 — CID 143738431
(3R,5R)-7-[5-(4-fluorophenyl)-3-[(2-hydroxycyclohexa-1,5-dien-1-yl)carbamoyl]-4-phenyl-2-propan-2-yl-2,3-dihydropyrrol-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 143738431) has the molecular formula C33H39FN2O6 and a molecular weight of 578.68 g/mol. Its IUPAC name is (3R,5R)-7-[5-(4-fluorophenyl)-3-[(2-hydroxycyclohexa-1,5-dien-1-yl)carbamoyl]-4-phenyl-2-propan-2-yl-2,3-dihydropyrrol-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[5-(4-fluorophenyl)-3-[(2-hydroxycyclohexa-1,5-dien-1-yl)carbamoyl]-4-phenyl-2-propan-2-yl-2,3-dihydropyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 143738431 |
| Molecular Formula | C33H39FN2O6 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | (3R,5R)-7-[5-(4-fluorophenyl)-3-[(2-hydroxycyclohexa-1,5-dien-1-yl)carbamoyl]-4-phenyl-2-propan-2-yl-2,3-dihydropyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CC(C)C1C(C(=O)NC2=C(O)CCC=C2)C(c2ccccc2)=C(c2ccc(F)cc2)N1CC[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C33H39FN2O6/c1-20(2)31-30(33(42)35-26-10-6-7-11-27(26)39)29(21-8-4-3-5-9-21)32(22-12-14-23(34)15-13-22)36(31)17-16-24(37)18-25(38)19-28(40)41/h3-6,8-10,12-15,20,24-25,30-31,37-39H,7,11,16-19H2,1-2H3,(H,35,42)(H,40,41)/t24-,25-,30?,31?/m1/s1 |
| InChIKey | DSCMXGYXIDFPJR-XEMPMCCSSA-N |
| XLogP | 4.86 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|