C31H36FN3O3 — CID 143282187
N-cyclohexa-1,5-dien-1-yl-5-(4-fluorophenyl)-1-(3-hydroxy-5-oxopentyl)-4-phenyl-2-propan-2-yl-2,3-dihydropyrrole-3-carbohydrazide (PubChem CID 143282187) has the molecular formula C31H36FN3O3 and a molecular weight of 517.65 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-5-(4-fluorophenyl)-1-(3-hydroxy-5-oxopentyl)-4-phenyl-2-propan-2-yl-2,3-dihydropyrrole-3-carbohydrazide.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-5-(4-fluorophenyl)-1-(3-hydroxy-5-oxopentyl)-4-phenyl-2-propan-2-yl-2,3-dihydropyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 143282187 |
| Molecular Formula | C31H36FN3O3 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-5-(4-fluorophenyl)-1-(3-hydroxy-5-oxopentyl)-4-phenyl-2-propan-2-yl-2,3-dihydropyrrole-3-carbohydrazide |
| SMILES | CC(C)C1C(C(=O)N(N)C2=CCCC=C2)C(c2ccccc2)=C(c2ccc(F)cc2)N1CCC(O)CC=O |
| InChI | InChI=1S/C31H36FN3O3/c1-21(2)29-28(31(38)35(33)25-11-7-4-8-12-25)27(22-9-5-3-6-10-22)30(23-13-15-24(32)16-14-23)34(29)19-17-26(37)18-20-36/h3,5-7,9-16,20-21,26,28-29,37H,4,8,17-19,33H2,1-2H3 |
| InChIKey | DHMGXCSBLRHXNY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|