C24H27N9O2 — CID 143740320
[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methyl 2-amino-3-hydrazinyl-6-methyl-4-naphthalen-1-yl-4H-pyrimidine-5-carboxylate (PubChem CID 143740320) has the molecular formula C24H27N9O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is [4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methyl 2-amino-3-hydrazinyl-6-methyl-4-naphthalen-1-yl-4H-pyrimidine-5-carboxylate.
| Compound Name | [4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methyl 2-amino-3-hydrazinyl-6-methyl-4-naphthalen-1-yl-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 143740320 |
| Molecular Formula | C24H27N9O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | [4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methyl 2-amino-3-hydrazinyl-6-methyl-4-naphthalen-1-yl-4H-pyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccc(/C(=N/N)NN)cc2)C(c2cccc3ccccc23)N(NN)C(N)=N1 |
| InChI | InChI=1S/C24H27N9O2/c1-14-20(23(34)35-13-15-9-11-17(12-10-15)22(30-26)31-27)21(33(32-28)24(25)29-14)19-8-4-6-16-5-2-3-7-18(16)19/h2-12,21,32H,13,26-28H2,1H3,(H2,25,29)(H,30,31) |
| InChIKey | WMFHUXKSHAUVFR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 182.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|