C25H22N3O2+ — CID 91074031
benzyl 4,5-dimethyl-2-naphthalen-1-yl-5,7-diaza-1-azoniabicyclo[4.2.0]octa-1(6),3,7-triene-3-carboxylate (PubChem CID 91074031) has the molecular formula C25H22N3O2+ and a molecular weight of 396.47 g/mol. Its IUPAC name is benzyl 4,5-dimethyl-2-naphthalen-1-yl-5,7-diaza-1-azoniabicyclo[4.2.0]octa-1(6),3,7-triene-3-carboxylate.
| Compound Name | benzyl 4,5-dimethyl-2-naphthalen-1-yl-5,7-diaza-1-azoniabicyclo[4.2.0]octa-1(6),3,7-triene-3-carboxylate |
|---|---|
| PubChem CID | 91074031 |
| Molecular Formula | C25H22N3O2+ |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | benzyl 4,5-dimethyl-2-naphthalen-1-yl-5,7-diaza-1-azoniabicyclo[4.2.0]octa-1(6),3,7-triene-3-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C(c2cccc3ccccc23)[N+]2=C(N=C2)N1C |
| InChI | InChI=1S/C25H22N3O2/c1-17-22(24(29)30-15-18-9-4-3-5-10-18)23(28-16-26-25(28)27(17)2)21-14-8-12-19-11-6-7-13-20(19)21/h3-14,16,23H,15H2,1-2H3/q+1 |
| InChIKey | TZNFMZHNXILNNE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|