C18H22N2O4 — CID 121281539
3-O-benzyl 4-O-tert-butyl 1,5-dimethylpyrazole-3,4-dicarboxylate (PubChem CID 121281539) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-O-benzyl 4-O-tert-butyl 1,5-dimethylpyrazole-3,4-dicarboxylate.
| Compound Name | 3-O-benzyl 4-O-tert-butyl 1,5-dimethylpyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 121281539 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3-O-benzyl 4-O-tert-butyl 1,5-dimethylpyrazole-3,4-dicarboxylate |
| SMILES | Cc1c(C(=O)OC(C)(C)C)c(C(=O)OCc2ccccc2)nn1C |
| InChI | InChI=1S/C18H22N2O4/c1-12-14(16(21)24-18(2,3)4)15(19-20(12)5)17(22)23-11-13-9-7-6-8-10-13/h6-10H,11H2,1-5H3 |
| InChIKey | DBEKCFICMWOMQS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |