C28H28N2O4 — CID 134443805
dibenzyl 7-tert-butyl-1-methylindazole-3,4-dicarboxylate (PubChem CID 134443805) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is dibenzyl 7-tert-butyl-1-methylindazole-3,4-dicarboxylate.
| Compound Name | dibenzyl 7-tert-butyl-1-methylindazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 134443805 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | dibenzyl 7-tert-butyl-1-methylindazole-3,4-dicarboxylate |
| SMILES | Cn1nc(C(=O)OCc2ccccc2)c2c(C(=O)OCc3ccccc3)ccc(C(C)(C)C)c21 |
| InChI | InChI=1S/C28H28N2O4/c1-28(2,3)22-16-15-21(26(31)33-17-19-11-7-5-8-12-19)23-24(29-30(4)25(22)23)27(32)34-18-20-13-9-6-10-14-20/h5-16H,17-18H2,1-4H3 |
| InChIKey | JADRGPSDYRYPJI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |