C21H21NO2S — CID 44557232
benzyl 5-tert-butyl-2-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 44557232) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is benzyl 5-tert-butyl-2-phenyl-1,3-thiazole-4-carboxylate.
| Compound Name | benzyl 5-tert-butyl-2-phenyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 44557232 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | benzyl 5-tert-butyl-2-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)(C)c1sc(-c2ccccc2)nc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H21NO2S/c1-21(2,3)18-17(20(23)24-14-15-10-6-4-7-11-15)22-19(25-18)16-12-8-5-9-13-16/h4-13H,14H2,1-3H3 |
| InChIKey | BYUWYMLIKBMLFE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |