C27H31F2N4O5S+ — CID 143741789
CID 143741789 (PubChem CID 143741789) has the molecular formula C27H31F2N4O5S+ and a molecular weight of 561.63 g/mol.
| Compound Name | CID 143741789 |
|---|---|
| PubChem CID | 143741789 |
| Molecular Formula | C27H31F2N4O5S+ |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | — |
| SMILES | C[C@H]1COCCN1c1cc(C[S+](=O)(O)c2cc(F)ccc2F)nc(-c2ccc(NC(=O)OC(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C27H30F2N4O5S/c1-17-15-37-12-11-33(17)24-14-21(16-39(35,36)23-13-19(28)7-10-22(23)29)30-25(32-24)18-5-8-20(9-6-18)31-26(34)38-27(2,3)4/h5-10,13-14,17H,11-12,15-16H2,1-4H3,(H-,30,31,32,34,35,36)/p+1/t17-/m0/s1 |
| InChIKey | RUWYUBCRDDBMRQ-KRWDZBQOSA-O |
| XLogP | 5.53 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|