C20H20 — CID 143743667
1,2-bis(ethenyl)-3,5-dimethylbenzo[10]annulene (PubChem CID 143743667) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-3,5-dimethylbenzo[10]annulene.
| Compound Name | 1,2-bis(ethenyl)-3,5-dimethylbenzo[10]annulene |
|---|---|
| PubChem CID | 143743667 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1,2-bis(ethenyl)-3,5-dimethylbenzo[10]annulene |
| SMILES | C=Cc1c(C)cc2c(C)cccccccc2c1C=C |
| InChI | InChI=1S/C20H20/c1-5-17-16(4)14-20-15(3)12-10-8-7-9-11-13-19(20)18(17)6-2/h5-14H,1-2H2,3-4H3/b8-7-,9-7-,10-8-,11-9+,12-10+,13-11+,15-12+,19-13-,20-15- |
| InChIKey | DETPPSSNVZSEAL-XFBDPGASSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |