C17H18 — CID 143715386
2,3-bis(ethenyl)-1,4,5-trimethylnaphthalene (PubChem CID 143715386) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1,4,5-trimethylnaphthalene.
| Compound Name | 2,3-bis(ethenyl)-1,4,5-trimethylnaphthalene |
|---|---|
| PubChem CID | 143715386 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2,3-bis(ethenyl)-1,4,5-trimethylnaphthalene |
| SMILES | C=Cc1c(C=C)c(C)c2c(C)cccc2c1C |
| InChI | InChI=1S/C17H18/c1-6-14-12(4)16-10-8-9-11(3)17(16)13(5)15(14)7-2/h6-10H,1-2H2,3-5H3 |
| InChIKey | PJGMDAVAJJVWBV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |