About butan-1-amine;2-methylhex-1-en-3-one
butan-1-amine;2-methylhex-1-en-3-one (PubChem CID 143745185) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is butan-1-amine;2-methylhex-1-en-3-one.
Molecular Properties
| Compound Name | butan-1-amine;2-methylhex-1-en-3-one |
| PubChem CID | 143745185 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | butan-1-amine;2-methylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)CCC.CCCCN |
| InChI | InChI=1S/C7H12O.C4H11N/c1-4-5-7(8)6(2)3;1-2-3-4-5/h2,4-5H2,1,3H3;2-5H2,1H3 |
| InChIKey | YGJTWXSWJIOOHV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-1-amine;2-methylhex-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;2-methylhex-1-en-3-one?
The IUPAC name of butan-1-amine;2-methylhex-1-en-3-one (CID 143745185) is butan-1-amine;2-methylhex-1-en-3-one.
What is the SMILES notation for butan-1-amine;2-methylhex-1-en-3-one?
The canonical SMILES for butan-1-amine;2-methylhex-1-en-3-one is C=C(C)C(=O)CCC.CCCCN.
What is the InChIKey of butan-1-amine;2-methylhex-1-en-3-one?
The InChIKey is YGJTWXSWJIOOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C4H11N/c1-4-5-7(8)6(2)3;1-2-3-4-5/h2,4-5H2,1,3H3;2-5H2,1H3.
What are the key properties of butan-1-amine;2-methylhex-1-en-3-one?
butan-1-amine;2-methylhex-1-en-3-one has a molecular weight of 185.31 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;2-methylhex-1-en-3-one is sourced from PubChem (CID 143745185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).