C15H27N — CID 143745628
1-[(Z,4Z)-4-ethylidenehept-5-enyl]-4-methylpiperidine (PubChem CID 143745628) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 1-[(Z,4Z)-4-ethylidenehept-5-enyl]-4-methylpiperidine.
| Compound Name | 1-[(Z,4Z)-4-ethylidenehept-5-enyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 143745628 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 1-[(Z,4Z)-4-ethylidenehept-5-enyl]-4-methylpiperidine |
| SMILES | C/C=C\C(=C/C)CCCN1CCC(C)CC1 |
| InChI | InChI=1S/C15H27N/c1-4-7-15(5-2)8-6-11-16-12-9-14(3)10-13-16/h4-5,7,14H,6,8-13H2,1-3H3/b7-4-,15-5+ |
| InChIKey | FGAPVJCBBVHADC-LWNSUNLVSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|