C18H35NO2 — CID 123958631
1-[9-(1,3-dioxolan-2-yl)nonyl]-4-methylpiperidine (PubChem CID 123958631) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is 1-[9-(1,3-dioxolan-2-yl)nonyl]-4-methylpiperidine.
| Compound Name | 1-[9-(1,3-dioxolan-2-yl)nonyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 123958631 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | 1-[9-(1,3-dioxolan-2-yl)nonyl]-4-methylpiperidine |
| SMILES | CC1CCN(CCCCCCCCCC2OCCO2)CC1 |
| InChI | InChI=1S/C18H35NO2/c1-17-10-13-19(14-11-17)12-8-6-4-2-3-5-7-9-18-20-15-16-21-18/h17-18H,2-16H2,1H3 |
| InChIKey | OBFJHSWIUAQLON-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|