C12H23NO3 — CID 66473510
1-[2-(1,3-dioxan-2-yl)ethyl]-4-methoxypiperidine (PubChem CID 66473510) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 1-[2-(1,3-dioxan-2-yl)ethyl]-4-methoxypiperidine.
| Compound Name | 1-[2-(1,3-dioxan-2-yl)ethyl]-4-methoxypiperidine |
|---|---|
| PubChem CID | 66473510 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 1-[2-(1,3-dioxan-2-yl)ethyl]-4-methoxypiperidine |
| SMILES | COC1CCN(CCC2OCCCO2)CC1 |
| InChI | InChI=1S/C12H23NO3/c1-14-11-3-6-13(7-4-11)8-5-12-15-9-2-10-16-12/h11-12H,2-10H2,1H3 |
| InChIKey | HBSDZGGHWDFOBC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |