C13H26N2O2 — CID 66474133
4-[2-(1,3-dioxan-2-yl)ethyl]-2-ethyl-1-methylpiperazine (PubChem CID 66474133) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-[2-(1,3-dioxan-2-yl)ethyl]-2-ethyl-1-methylpiperazine.
| Compound Name | 4-[2-(1,3-dioxan-2-yl)ethyl]-2-ethyl-1-methylpiperazine |
|---|---|
| PubChem CID | 66474133 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4-[2-(1,3-dioxan-2-yl)ethyl]-2-ethyl-1-methylpiperazine |
| SMILES | CCC1CN(CCC2OCCCO2)CCN1C |
| InChI | InChI=1S/C13H26N2O2/c1-3-12-11-15(8-7-14(12)2)6-5-13-16-9-4-10-17-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | QNXLUCUPHNRPPI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |