C26H26N2O3 — CID 143748109
3-methylcyclobut-3-ene-1,2-dione;4-methylpyridine;2-(3-phenylphenyl)propanamide (PubChem CID 143748109) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-methylcyclobut-3-ene-1,2-dione;4-methylpyridine;2-(3-phenylphenyl)propanamide.
| Compound Name | 3-methylcyclobut-3-ene-1,2-dione;4-methylpyridine;2-(3-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 143748109 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-methylcyclobut-3-ene-1,2-dione;4-methylpyridine;2-(3-phenylphenyl)propanamide |
| SMILES | CC(C(N)=O)c1cccc(-c2ccccc2)c1.Cc1cc(=O)c1=O.Cc1ccncc1 |
| InChI | InChI=1S/C15H15NO.C6H7N.C5H4O2/c1-11(15(16)17)13-8-5-9-14(10-13)12-6-3-2-4-7-12;1-6-2-4-7-5-3-6;1-3-2-4(6)5(3)7/h2-11H,1H3,(H2,16,17);2-5H,1H3;2H,1H3 |
| InChIKey | TWNVIWBCTPLCHG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|