C21H24N2O3 — CID 143748150
3-methylcyclobut-3-ene-1,2-dione;(2S)-N-methyl-2-phenylpropanamide;4-methylpyridine (PubChem CID 143748150) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-methylcyclobut-3-ene-1,2-dione;(2S)-N-methyl-2-phenylpropanamide;4-methylpyridine.
| Compound Name | 3-methylcyclobut-3-ene-1,2-dione;(2S)-N-methyl-2-phenylpropanamide;4-methylpyridine |
|---|---|
| PubChem CID | 143748150 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-methylcyclobut-3-ene-1,2-dione;(2S)-N-methyl-2-phenylpropanamide;4-methylpyridine |
| SMILES | CNC(=O)[C@@H](C)c1ccccc1.Cc1cc(=O)c1=O.Cc1ccncc1 |
| InChI | InChI=1S/C10H13NO.C6H7N.C5H4O2/c1-8(10(12)11-2)9-6-4-3-5-7-9;1-6-2-4-7-5-3-6;1-3-2-4(6)5(3)7/h3-8H,1-2H3,(H,11,12);2-5H,1H3;2H,1H3/t8-;;/m0../s1 |
| InChIKey | GHMVOHAXFDHDTD-JZGIKJSDSA-N |
| XLogP | 2.52 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|