C33H31ClFN5O2 — CID 143748778
6-[1-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]pyrrol-3-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine (PubChem CID 143748778) has the molecular formula C33H31ClFN5O2 and a molecular weight of 584.10 g/mol. Its IUPAC name is 6-[1-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]pyrrol-3-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine.
| Compound Name | 6-[1-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]pyrrol-3-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 143748778 |
| Molecular Formula | C33H31ClFN5O2 |
| Molecular Weight | 584.10 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | 6-[1-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]pyrrol-3-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine |
| SMILES | Fc1cccc(COc2ccc(Nc3ncnc4ccc(-c5ccn(C[C@H]6CN7CCC[C@@H]7CO6)c5)cc34)cc2Cl)c1 |
| InChI | InChI=1S/C33H31ClFN5O2/c34-30-15-26(7-9-32(30)42-19-22-3-1-4-25(35)13-22)38-33-29-14-23(6-8-31(29)36-21-37-33)24-10-12-39(16-24)17-28-18-40-11-2-5-27(40)20-41-28/h1,3-4,6-10,12-16,21,27-28H,2,5,11,17-20H2,(H,36,37,38)/t27-,28+/m1/s1 |
| InChIKey | RXDKUWJNLWVQHY-IZLXSDGUSA-N |
| XLogP | 7.08 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.10 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |