C27H44N4O4S — CID 143749610
N-[2-[2-[(3aR,6aS)-2-[(1-methylpiperidin-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfinamide (PubChem CID 143749610) has the molecular formula C27H44N4O4S and a molecular weight of 520.74 g/mol. Its IUPAC name is N-[2-[2-[(3aR,6aS)-2-[(1-methylpiperidin-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfinamide.
| Compound Name | N-[2-[2-[(3aR,6aS)-2-[(1-methylpiperidin-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfinamide |
|---|---|
| PubChem CID | 143749610 |
| Molecular Formula | C27H44N4O4S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | N-[2-[2-[(3aR,6aS)-2-[(1-methylpiperidin-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfinamide |
| SMILES | COc1cc(C)c(S(=O)N(C)CCOCC(=O)N2C[C@H]3CN(CC4CCN(C)CC4)C[C@H]3C2)c(C)c1 |
| InChI | InChI=1S/C27H44N4O4S/c1-20-12-25(34-5)13-21(2)27(20)36(33)29(4)10-11-35-19-26(32)31-17-23-15-30(16-24(23)18-31)14-22-6-8-28(3)9-7-22/h12-13,22-24H,6-11,14-19H2,1-5H3/t23-,24+,36? |
| InChIKey | RUPKHOMFWLQQNC-PCEFRLEOSA-N |
| XLogP | 2.02 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|