C27H35N3O2 — CID 143751108
1-[4-(2,2-dimethylpropylamino)-3-methanimidoylphenyl]-4-phenylmethoxypyridin-2-one;propane (PubChem CID 143751108) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-[4-(2,2-dimethylpropylamino)-3-methanimidoylphenyl]-4-phenylmethoxypyridin-2-one;propane.
| Compound Name | 1-[4-(2,2-dimethylpropylamino)-3-methanimidoylphenyl]-4-phenylmethoxypyridin-2-one;propane |
|---|---|
| PubChem CID | 143751108 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 1-[4-(2,2-dimethylpropylamino)-3-methanimidoylphenyl]-4-phenylmethoxypyridin-2-one;propane |
| SMILES | CCC.[H]/N=C/c1cc(-n2ccc(OCc3ccccc3)cc2=O)ccc1NCC(C)(C)C |
| InChI | InChI=1S/C24H27N3O2.C3H8/c1-24(2,3)17-26-22-10-9-20(13-19(22)15-25)27-12-11-21(14-23(27)28)29-16-18-7-5-4-6-8-18;1-3-2/h4-15,25-26H,16-17H2,1-3H3;3H2,1-2H3/b25-15+; |
| InChIKey | NNCHEGHWLJIBFO-BUWMAIPZSA-N |
| XLogP | 6.29 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|