C26H31N5O — CID 143723336
1-[3-methanimidoyl-4-(2-piperazin-1-ylethylamino)phenyl]-4-(2-phenylethyl)pyridin-2-one (PubChem CID 143723336) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is 1-[3-methanimidoyl-4-(2-piperazin-1-ylethylamino)phenyl]-4-(2-phenylethyl)pyridin-2-one.
| Compound Name | 1-[3-methanimidoyl-4-(2-piperazin-1-ylethylamino)phenyl]-4-(2-phenylethyl)pyridin-2-one |
|---|---|
| PubChem CID | 143723336 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 1-[3-methanimidoyl-4-(2-piperazin-1-ylethylamino)phenyl]-4-(2-phenylethyl)pyridin-2-one |
| SMILES | [H]/N=C/c1cc(-n2ccc(CCc3ccccc3)cc2=O)ccc1NCCN1CCNCC1 |
| InChI | InChI=1S/C26H31N5O/c27-20-23-19-24(8-9-25(23)29-13-17-30-15-11-28-12-16-30)31-14-10-22(18-26(31)32)7-6-21-4-2-1-3-5-21/h1-5,8-10,14,18-20,27-29H,6-7,11-13,15-17H2/b27-20+ |
| InChIKey | LDTRLIREZNPVOC-NHFJDJAPSA-N |
| XLogP | 2.94 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|