C15H24N2O6 — CID 143751253
(2,5-dioxopyrrolidin-1-yl) acetate;ethane;1-methylpyrrole-2,5-dione (PubChem CID 143751253) has the molecular formula C15H24N2O6 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) acetate;ethane;1-methylpyrrole-2,5-dione.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) acetate;ethane;1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 143751253 |
| Molecular Formula | C15H24N2O6 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) acetate;ethane;1-methylpyrrole-2,5-dione |
| SMILES | CC.CC.CC(=O)ON1C(=O)CCC1=O.CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H7NO4.C5H5NO2.2C2H6/c1-4(8)11-7-5(9)2-3-6(7)10;1-6-4(7)2-3-5(6)8;2*1-2/h2-3H2,1H3;2-3H,1H3;2*1-2H3 |
| InChIKey | XMDLPEMDHPBEEG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|