C15H16Cl2N2OS — CID 143751490
2-(3-butan-2-yl-6,7-dichloro-4-sulfanylidene-1H-quinolin-2-yl)acetamide (PubChem CID 143751490) has the molecular formula C15H16Cl2N2OS and a molecular weight of 343.28 g/mol. Its IUPAC name is 2-(3-butan-2-yl-6,7-dichloro-4-sulfanylidene-1H-quinolin-2-yl)acetamide.
| Compound Name | 2-(3-butan-2-yl-6,7-dichloro-4-sulfanylidene-1H-quinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 143751490 |
| Molecular Formula | C15H16Cl2N2OS |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-(3-butan-2-yl-6,7-dichloro-4-sulfanylidene-1H-quinolin-2-yl)acetamide |
| SMILES | CCC(C)c1c(CC(N)=O)[nH]c2cc(Cl)c(Cl)cc2c1=S |
| InChI | InChI=1S/C15H16Cl2N2OS/c1-3-7(2)14-12(6-13(18)20)19-11-5-10(17)9(16)4-8(11)15(14)21/h4-5,7H,3,6H2,1-2H3,(H2,18,20)(H,19,21) |
| InChIKey | YMPBUIFCCXZUAG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|