C20H8Cl4N2O2 — CID 58607360
2,3,9,10-tetrachloro-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (PubChem CID 58607360) has the molecular formula C20H8Cl4N2O2 and a molecular weight of 450.11 g/mol. Its IUPAC name is 2,3,9,10-tetrachloro-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 2,3,9,10-tetrachloro-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 58607360 |
| Molecular Formula | C20H8Cl4N2O2 |
| Molecular Weight | 450.11 g/mol |
| Exact Mass | 447.93 |
| IUPAC Name | 2,3,9,10-tetrachloro-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
| SMILES | O=c1c2cc(Cl)c(Cl)cc2[nH]c2cc3c(=O)c4cc(Cl)c(Cl)cc4[nH]c3cc12 |
| InChI | InChI=1S/C20H8Cl4N2O2/c21-11-1-7-17(5-13(11)23)25-15-4-10-16(3-9(15)19(7)27)26-18-6-14(24)12(22)2-8(18)20(10)28/h1-6H,(H,25,27)(H,26,28) |
| InChIKey | VJQFODKXQDXLBL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.11 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|