C24H31FN4O3 — CID 143752867
3-[2-[4-[(Z)-C-(4-fluoro-2-methylphenyl)-N-hydroxycarbonimidoyl]piperidin-1-yl]ethyl]-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 143752867) has the molecular formula C24H31FN4O3 and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-[2-[4-[(Z)-C-(4-fluoro-2-methylphenyl)-N-hydroxycarbonimidoyl]piperidin-1-yl]ethyl]-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[2-[4-[(Z)-C-(4-fluoro-2-methylphenyl)-N-hydroxycarbonimidoyl]piperidin-1-yl]ethyl]-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 143752867 |
| Molecular Formula | C24H31FN4O3 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 3-[2-[4-[(Z)-C-(4-fluoro-2-methylphenyl)-N-hydroxycarbonimidoyl]piperidin-1-yl]ethyl]-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cc(F)ccc1/C(=N\O)C1CCN(CCc2c(C)nc3n(c2=O)CCCC3O)CC1 |
| InChI | InChI=1S/C24H31FN4O3/c1-15-14-18(25)5-6-19(15)22(27-32)17-7-11-28(12-8-17)13-9-20-16(2)26-23-21(30)4-3-10-29(23)24(20)31/h5-6,14,17,21,30,32H,3-4,7-13H2,1-2H3/b27-22- |
| InChIKey | IGLVGPHDLYYVRC-QYQHSDTDSA-N |
| XLogP | 2.96 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|