C29H37FN4O5 — CID 88926304
[3-[2-[4-[1-(2-aminooxy-4-fluorophenyl)ethenyl]piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] 5-oxopentanoate (PubChem CID 88926304) has the molecular formula C29H37FN4O5 and a molecular weight of 540.64 g/mol. Its IUPAC name is [3-[2-[4-[1-(2-aminooxy-4-fluorophenyl)ethenyl]piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] 5-oxopentanoate.
| Compound Name | [3-[2-[4-[1-(2-aminooxy-4-fluorophenyl)ethenyl]piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] 5-oxopentanoate |
|---|---|
| PubChem CID | 88926304 |
| Molecular Formula | C29H37FN4O5 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | [3-[2-[4-[1-(2-aminooxy-4-fluorophenyl)ethenyl]piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] 5-oxopentanoate |
| SMILES | C=C(c1ccc(F)cc1ON)C1CCN(CCc2c(C)nc3n(c2=O)CCCC3OC(=O)CCCC=O)CC1 |
| InChI | InChI=1S/C29H37FN4O5/c1-19(23-9-8-22(30)18-26(23)39-31)21-10-14-33(15-11-21)16-12-24-20(2)32-28-25(6-5-13-34(28)29(24)37)38-27(36)7-3-4-17-35/h8-9,17-18,21,25H,1,3-7,10-16,31H2,2H3 |
| InChIKey | ASODTOPZCUEZSS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|