C27H42N8O3 — CID 143754129
3-amino-N-[4-[[amino-[(Z)-[amino-(2-formyl-6-methyl-4-pyridinyl)methylidene]amino]amino]methyl]cyclohexyl]propanamide;1-(3-methoxyphenyl)-N-methylmethanamine (PubChem CID 143754129) has the molecular formula C27H42N8O3 and a molecular weight of 526.69 g/mol. Its IUPAC name is 3-amino-N-[4-[[amino-[(Z)-[amino-(2-formyl-6-methyl-4-pyridinyl)methylidene]amino]amino]methyl]cyclohexyl]propanamide;1-(3-methoxyphenyl)-N-methylmethanamine.
| Compound Name | 3-amino-N-[4-[[amino-[(Z)-[amino-(2-formyl-6-methyl-4-pyridinyl)methylidene]amino]amino]methyl]cyclohexyl]propanamide;1-(3-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 143754129 |
| Molecular Formula | C27H42N8O3 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | 3-amino-N-[4-[[amino-[(Z)-[amino-(2-formyl-6-methyl-4-pyridinyl)methylidene]amino]amino]methyl]cyclohexyl]propanamide;1-(3-methoxyphenyl)-N-methylmethanamine |
| SMILES | CNCc1cccc(OC)c1.Cc1cc(/C(N)=N/N(N)CC2CCC(NC(=O)CCN)CC2)cc(C=O)n1 |
| InChI | InChI=1S/C18H29N7O2.C9H13NO/c1-12-8-14(9-16(11-26)22-12)18(20)24-25(21)10-13-2-4-15(5-3-13)23-17(27)6-7-19;1-10-7-8-4-3-5-9(6-8)11-2/h8-9,11,13,15H,2-7,10,19,21H2,1H3,(H2,20,24)(H,23,27);3-6,10H,7H2,1-2H3 |
| InChIKey | FWGUHVITRMFLIZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|