C21H28N6O3 — CID 143754327
4-[(Z)-N'-[amino(oxolan-2-ylmethyl)amino]carbamimidoyl]-N-[(3-methoxyphenyl)methyl]-6-methylpyridine-2-carboxamide (PubChem CID 143754327) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[(Z)-N'-[amino(oxolan-2-ylmethyl)amino]carbamimidoyl]-N-[(3-methoxyphenyl)methyl]-6-methylpyridine-2-carboxamide.
| Compound Name | 4-[(Z)-N'-[amino(oxolan-2-ylmethyl)amino]carbamimidoyl]-N-[(3-methoxyphenyl)methyl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 143754327 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-[(Z)-N'-[amino(oxolan-2-ylmethyl)amino]carbamimidoyl]-N-[(3-methoxyphenyl)methyl]-6-methylpyridine-2-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2cc(/C(N)=N/N(N)CC3CCCO3)cc(C)n2)c1 |
| InChI | InChI=1S/C21H28N6O3/c1-14-9-16(20(22)26-27(23)13-18-7-4-8-30-18)11-19(25-14)21(28)24-12-15-5-3-6-17(10-15)29-2/h3,5-6,9-11,18H,4,7-8,12-13,23H2,1-2H3,(H2,22,26)(H,24,28) |
| InChIKey | IQIDWIYVXNAQJR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|