C24H36N6O2 — CID 143754027
4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-6-methyl-N-[(3-methylphenyl)methyl]pyridine-2-carboxamide;cyclohexylmethanol (PubChem CID 143754027) has the molecular formula C24H36N6O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-6-methyl-N-[(3-methylphenyl)methyl]pyridine-2-carboxamide;cyclohexylmethanol.
| Compound Name | 4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-6-methyl-N-[(3-methylphenyl)methyl]pyridine-2-carboxamide;cyclohexylmethanol |
|---|---|
| PubChem CID | 143754027 |
| Molecular Formula | C24H36N6O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-6-methyl-N-[(3-methylphenyl)methyl]pyridine-2-carboxamide;cyclohexylmethanol |
| SMILES | Cc1cccc(CNC(=O)c2cc(/C(N)=N/N(C)N)cc(C)n2)c1.OCC1CCCCC1 |
| InChI | InChI=1S/C17H22N6O.C7H14O/c1-11-5-4-6-13(7-11)10-20-17(24)15-9-14(8-12(2)21-15)16(18)22-23(3)19;8-6-7-4-2-1-3-5-7/h4-9H,10,19H2,1-3H3,(H2,18,22)(H,20,24);7-8H,1-6H2 |
| InChIKey | YVYXVXOJXGZWKI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|