C25H38N8O5 — CID 143753950
6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[[3-(2-hydroxyethoxy)phenyl]methyl]-2-methylpyrimidine-4-carboxamide;N-cyclohexyl-2-hydroxyacetamide (PubChem CID 143753950) has the molecular formula C25H38N8O5 and a molecular weight of 530.63 g/mol. Its IUPAC name is 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[[3-(2-hydroxyethoxy)phenyl]methyl]-2-methylpyrimidine-4-carboxamide;N-cyclohexyl-2-hydroxyacetamide.
| Compound Name | 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[[3-(2-hydroxyethoxy)phenyl]methyl]-2-methylpyrimidine-4-carboxamide;N-cyclohexyl-2-hydroxyacetamide |
|---|---|
| PubChem CID | 143753950 |
| Molecular Formula | C25H38N8O5 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[[3-(2-hydroxyethoxy)phenyl]methyl]-2-methylpyrimidine-4-carboxamide;N-cyclohexyl-2-hydroxyacetamide |
| SMILES | Cc1nc(C(=O)NCc2cccc(OCCO)c2)cc(/C(N)=N/N(C)N)n1.O=C(CO)NC1CCCCC1 |
| InChI | InChI=1S/C17H23N7O3.C8H15NO2/c1-11-21-14(16(18)23-24(2)19)9-15(22-11)17(26)20-10-12-4-3-5-13(8-12)27-7-6-25;10-6-8(11)9-7-4-2-1-3-5-7/h3-5,8-9,25H,6-7,10,19H2,1-2H3,(H2,18,23)(H,20,26);7,10H,1-6H2,(H,9,11) |
| InChIKey | BMCUSINBXLVBNX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 201.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|