C22H33ClFN7O3 — CID 143754275
6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-chloro-4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide;cyclohexanol;methanol (PubChem CID 143754275) has the molecular formula C22H33ClFN7O3 and a molecular weight of 498.00 g/mol. Its IUPAC name is 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-chloro-4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide;cyclohexanol;methanol.
| Compound Name | 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-chloro-4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide;cyclohexanol;methanol |
|---|---|
| PubChem CID | 143754275 |
| Molecular Formula | C22H33ClFN7O3 |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-chloro-4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide;cyclohexanol;methanol |
| SMILES | CO.Cc1nc(C(=O)NCc2ccc(F)c(Cl)c2)cc(/C(N)=N/N(C)N)n1.OC1CCCCC1 |
| InChI | InChI=1S/C15H17ClFN7O.C6H12O.CH4O/c1-8-21-12(14(18)23-24(2)19)6-13(22-8)15(25)20-7-9-3-4-11(17)10(16)5-9;7-6-4-2-1-3-5-6;1-2/h3-6H,7,19H2,1-2H3,(H2,18,23)(H,20,25);6-7H,1-5H2;2H,1H3 |
| InChIKey | VYJITEPJTYGBFS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|