C15H16FN5O2 — CID 141231946
6-carbamimidoyl-N-[(4-fluoro-3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 141231946) has the molecular formula C15H16FN5O2 and a molecular weight of 317.32 g/mol. Its IUPAC name is 6-carbamimidoyl-N-[(4-fluoro-3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-carbamimidoyl-N-[(4-fluoro-3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 141231946 |
| Molecular Formula | C15H16FN5O2 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 6-carbamimidoyl-N-[(4-fluoro-3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | [H]/N=C(\N)c1cc(C(=O)NCc2ccc(F)c(OC)c2)nc(C)n1 |
| InChI | InChI=1S/C15H16FN5O2/c1-8-20-11(14(17)18)6-12(21-8)15(22)19-7-9-3-4-10(16)13(5-9)23-2/h3-6H,7H2,1-2H3,(H3,17,18)(H,19,22) |
| InChIKey | VRJSZGQSQPIWOA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|