C23H31FN8O3 — CID 143754057
6-[(Z)-N'-[(3-acetamidocyclopentyl)methyl-aminoamino]carbamimidoyl]-N-[(4-fluoro-3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 143754057) has the molecular formula C23H31FN8O3 and a molecular weight of 486.55 g/mol. Its IUPAC name is 6-[(Z)-N'-[(3-acetamidocyclopentyl)methyl-aminoamino]carbamimidoyl]-N-[(4-fluoro-3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-[(Z)-N'-[(3-acetamidocyclopentyl)methyl-aminoamino]carbamimidoyl]-N-[(4-fluoro-3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143754057 |
| Molecular Formula | C23H31FN8O3 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 6-[(Z)-N'-[(3-acetamidocyclopentyl)methyl-aminoamino]carbamimidoyl]-N-[(4-fluoro-3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | COc1cc(CNC(=O)c2cc(/C(N)=N/N(N)CC3CCC(NC(C)=O)C3)nc(C)n2)ccc1F |
| InChI | InChI=1S/C23H31FN8O3/c1-13-28-19(22(25)31-32(26)12-16-4-6-17(8-16)30-14(2)33)10-20(29-13)23(34)27-11-15-5-7-18(24)21(9-15)35-3/h5,7,9-10,16-17H,4,6,8,11-12,26H2,1-3H3,(H2,25,31)(H,27,34)(H,30,33) |
| InChIKey | RRSHWDPOCRTAOC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|